|
|
| | 1-Benzhydryl-3-iodoazetidine Basic information |
| Product Name: | 1-Benzhydryl-3-iodoazetidine | | Synonyms: | 1-Benzhydryl-3-iodoazetidine;N-Benzhydryl-3-iodoazetidine;Azetidine, 1-(diphenylMethyl)-3-iodo-;3-Iodo-N-benzhydrylazetidine;1-Diphenylmethyl-3-iodazo heterocyclic butane;1-diphenylmethyl-3-iodoazacyclobutane | | CAS: | 125735-40-2 | | MF: | C16H16IN | | MW: | 349.21 | | EINECS: | | | Product Categories: | | | Mol File: | 125735-40-2.mol |  |
| | 1-Benzhydryl-3-iodoazetidine Chemical Properties |
| Melting point | 101~102℃ | | Boiling point | 377℃ | | density | 1.55 | | Fp | 182℃ | | storage temp. | 2-8°C(protect from light) | | pka | 6.16±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C16H16IN/c17-15-11-18(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 | | InChIKey | IBCVAYQWXMWFLD-UHFFFAOYSA-N | | SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(I)C1 |
| | 1-Benzhydryl-3-iodoazetidine Usage And Synthesis |
| Uses | 1-Benzhydryl-3-iodoazetidine is a useful research reagent used in the synthetic preparation of other pharmacologically active molecules. | | Synthesis | Step 1: Potassium iodide (530 mg, 3.14 mmol) was added to a mixed solution of 1-diphenylmethyl-3-methanesulfonic acid azetidine (500 mg, 1.57 mmol) in water (2.5 mL) and 1,2-dimethoxyethane (2.5 mL). The reaction mixture was stirred at room temperature and then heated to reflux and stirred continuously for 3 hours. After the reaction was completed, it was cooled to room temperature and diluted with water (50 mL) and ethyl acetate (50 mL). The aqueous phase was separated and extracted with ethyl acetate (2 x 70 mL). The organic phases were combined, washed with saturated sodium chloride solution (40 mL), dried over anhydrous sodium sulfate, filtered and concentrated to dryness to give 1-diphenylmethyl-3-iodoazetidine as a yellow solid (550 mg, 100% yield).LCMS (ESI-APCI) m/z 350.0 (M + H)+. | | References | [1] Patent: WO2011/61214, 2011, A1. Location in patent: Page/Page column 159-160
[2] Patent: EP992493, 2000, A1
[3] Patent: EP962457, 1999, A1 |
| | 1-Benzhydryl-3-iodoazetidine Preparation Products And Raw materials |
|