|
|
| | 2,2',4,5,5'-Pentachlorobiphenyl Basic information |
| Product Name: | 2,2',4,5,5'-Pentachlorobiphenyl | | Synonyms: | 2,4,5,2’,5’-pentachlorobiphenyl;2,5,2’,4’,5’-pentachlorobiphenyl;biphenyl,2,2’,4,5,5’-pentachloro-;PCB101/84;1,1'-BIPHENYL,2,2',4,5,5'-PEN;2,2μ,4,5,5μ-PCB, 2,2μ,4,5,5μ-Pentachlorobiphenyl solution;PCB No 101 solution;2,2μ,4,5,5μ-PCB, 2,2μ,4,5,5μ-Pentachlorobiphenyl | | CAS: | 37680-73-2 | | MF: | C12H5Cl5 | | MW: | 326.43 | | EINECS: | 621-393-0 | | Product Categories: | | | Mol File: | 37680-73-2.mol |  |
| | 2,2',4,5,5'-Pentachlorobiphenyl Chemical Properties |
| Melting point | 78℃ | | Boiling point | 412.3°C (rough estimate) | | density | 1.5220 (rough estimate) | | refractive index | 1.6200 (rough estimate) | | Fp | 4 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) | | Water Solubility | 11ug/L(25 ºC) | | BRN | 2507418 | | Henry's Law Constant | 3.2×10-2 mol/(m3Pa) at 25℃, Li et al. (2003) | | InChI | InChI=1S/C12H5Cl5/c13-6-1-2-9(14)7(3-6)8-4-11(16)12(17)5-10(8)15/h1-5H | | InChIKey | LAHWLEDBADHJGA-UHFFFAOYSA-N | | SMILES | C1(C2=CC(Cl)=CC=C2Cl)=CC(Cl)=C(Cl)C=C1Cl | | CAS DataBase Reference | 37680-73-2 | | EPA Substance Registry System | 2,2',4,5,5'-Pentachlorobiphenyl (37680-73-2) |
| | 2,2',4,5,5'-Pentachlorobiphenyl Usage And Synthesis |
| Uses | 2,2',4,5,5'-Pentachlorobiphenyl is a polychlorinated biphenyl (PCB) found in air, soil, mammals, and marine animals. |
| | 2,2',4,5,5'-Pentachlorobiphenyl Preparation Products And Raw materials |
|