| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:2',3',4',5',6'-PENTAMETHYLACETOPHENONE CAS:2040-01-9
|
|
| | 2',3',4',5',6'-PENTAMETHYLACETOPHENONE Basic information |
| Product Name: | 2',3',4',5',6'-PENTAMETHYLACETOPHENONE | | Synonyms: | 1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE;2',3',4',5',6'-PENTAMETHYLACETOPHENONE;2,3,4,5,6-PENTAMETHYLACETOPHENONE;PENTAMETHYLACETOPHENONE;Ethanone, 1-(pentamethylphenyl)-;1,2,3,4,5-Pentamethyl-6-acetylbenzene;1-(2,3,4,5,6-pentamethylphenyl)ethanone;1-(pentamethylphenyl)ethan-1-one | | CAS: | 2040-01-9 | | MF: | C13H18O | | MW: | 190.28 | | EINECS: | 218-033-6 | | Product Categories: | Building Blocks;C13 to C14;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks | | Mol File: | 2040-01-9.mol |  |
| | 2',3',4',5',6'-PENTAMETHYLACETOPHENONE Chemical Properties |
| Melting point | 84-86 °C(lit.) | | Boiling point | 144-145 °C(Press: 8 Torr) | | density | 0.940±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Off-white to light yellow Solid | | BRN | 1867535 | | InChI | 1S/C13H18O/c1-7-8(2)10(4)13(12(6)14)11(5)9(7)3/h1-6H3 | | InChIKey | CTTYWXDVWGKHKJ-UHFFFAOYSA-N | | SMILES | CC(=O)c1c(C)c(C)c(C)c(C)c1C | | CAS DataBase Reference | 2040-01-9(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2914500090 | | Storage Class | 13 - Non Combustible Solids |
| | 2',3',4',5',6'-PENTAMETHYLACETOPHENONE Usage And Synthesis |
| | 2',3',4',5',6'-PENTAMETHYLACETOPHENONE Preparation Products And Raw materials |
|