| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Bromochlorophen manufacturers
- BROMOCHLOROPHEN
-
- $7.00
-
2020-02-14
- CAS:15435-29-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | Bromochlorophen Basic information |
| Product Name: | Bromochlorophen | | Synonyms: | 4'-BROMO-4-CHLORO-2,2'-METHYLENE-BISPHENOL;BROMOCHLOROPHENE;2,2’-methylenebis(6-bromo-4-chloro-pheno;2,2’-methylenebis(6-bromo-4-chloro-Phenol;2,2’-methylenebis(6-bromo-4-chlorophenol);Bromchlorophen;Bis(3-bromo-5-chloro-2-hydroxyphenyl)methane
3,3'-Dibromo-5,5'-dichloro-2,2'-dihydroxydiphenylmethane
Bromochlorophen;Phenol, 2,2-methylenebis6-bromo-4-chloro- | | CAS: | 15435-29-7 | | MF: | C13H8Br2Cl2O2 | | MW: | 426.92 | | EINECS: | 239-446-8 | | Product Categories: | pharmacetical | | Mol File: | 15435-29-7.mol |  |
| | Bromochlorophen Chemical Properties |
| Melting point | 189 °C | | Boiling point | 452.3±40.0 °C(Predicted) | | density | 1.923±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.56±0.48(Predicted) | | color | White to Off-White | | Cosmetics Ingredients Functions | PRESERVATIVE DEODORANT ANTIMICROBIAL | | InChI | InChI=1S/C13H8Br2Cl2O2/c14-10-4-8(16)2-6(12(10)18)1-7-3-9(17)5-11(15)13(7)19/h2-5,18-19H,1H2 | | InChIKey | TYBHZVUFOINFDV-UHFFFAOYSA-N | | SMILES | C(C1=CC(Cl)=CC(Br)=C1O)C1=CC(Cl)=CC(Br)=C1O | | LogP | 6.267 (est) | | CAS DataBase Reference | 15435-29-7 |
| RTECS | SL9710000 | | HS Code | 2907.29.9000 |
| | Bromochlorophen Usage And Synthesis |
| Physical properties | Bromochlorophene solubility (g/L) in different solvents is as follows: water less than 0.01, 95% ethanol 0.5, propanol 0.7, isopropanol 0.4, propylene glycol 2.5, paraffin oil 0.05. | | Uses | Bromochlorophene is used as a microbicide in cosmetics, e.g.,
deodorants, mouthwashes, and toothpastes. | | Preparation | Bromochlorophene is produced by bromination of 2,2'-methylenebis(4-chlorophenol) in glacial acetic acid in the cold. | | Toxicity evaluation | LD50 (oral, rat)
3700 mg/kg, LD50 (oral, mouse) 1550 mg/kg,
LD50 (dermal, rat) > 10000 mg/kg. Bromochlorophene does not irritate the skin and there
is no evidence of sensitization. |
| | Bromochlorophen Preparation Products And Raw materials |
|