|
|
| | 4-[2-(4-methylpiperazin-1-yl)ethyl]aniline Basic information |
| Product Name: | 4-[2-(4-methylpiperazin-1-yl)ethyl]aniline | | Synonyms: | 4-[2-(4-methylpiperazin-1-yl)ethyl]aniline;[4-[2-(4-METHYLPIPERAZIN-1-YL)ETHYL]PHENYL]AMINE;OTAVA-BB 1036666;4-[2-(4-Methyl-1-piperazinyl)ethyl]aniline;Benzenamine, 4-[2-(4-methyl-1-piperazinyl)ethyl]- | | CAS: | 262368-48-9 | | MF: | C13H21N3 | | MW: | 219.33 | | EINECS: | | | Product Categories: | | | Mol File: | 262368-48-9.mol | ![4-[2-(4-methylpiperazin-1-yl)ethyl]aniline Structure](CAS/GIF/262368-48-9.gif) |
| | 4-[2-(4-methylpiperazin-1-yl)ethyl]aniline Chemical Properties |
| storage temp. | Store at Room Tem. | | form | solid | | InChI | 1S/C13H21N3/c1-15-8-10-16(11-9-15)7-6-12-2-4-13(14)5-3-12/h2-5H,6-11,14H2,1H3 | | InChIKey | BKUWHZDNFSRARB-UHFFFAOYSA-N | | SMILES | NC(C=C1)=CC=C1CCN2CCN(C)CC2 |
| WGK Germany | WGK 3 | | HS Code | 2922390090 | | Storage Class | 11 - Combustible Solids |
| | 4-[2-(4-methylpiperazin-1-yl)ethyl]aniline Usage And Synthesis |
| | 4-[2-(4-methylpiperazin-1-yl)ethyl]aniline Preparation Products And Raw materials |
|