| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| Product Name: | ZEATIN | | Synonyms: | trans-ZEATIN HYDROCHLORIDE (Z.HCl);(E)-4-((9H-purin-6-yl)aMino)-2-Methylbut-2-en-1-ol;6-(4-HYDROXY-3-METHYL-2-BUTENYLAMINO)PURINE;6-[4-HYDROXY-3-METHYLBUT-2-ENYLAMINO]PURINE TRANS ISOMER;6-[(E)-4-HYDROXY-3-METHYL-2-BUTENYLAMINE]PURINE;6[(E)-4-HYDROXY-3-METHYL-2-BUTENYLAMINO] PURINE;6-(HYDROXY-3-METHYL-BUT-2-ENYLAMINO)PURINE;trans-Zeatin hydrochloride plant cell culture tested, >=97% | | CAS: | 6025-81-6 | | MF: | C10H13N5O.ClH | | MW: | 255.7 | | EINECS: | | | Product Categories: | | | Mol File: | 6025-81-6.mol |  |
| | ZEATIN Chemical Properties |
| Melting point | 207 °C | | storage temp. | -20°C | | solubility | H2O: soluble | | form | powder | | color | off-white to yellow | | Water Solubility | H2O: soluble | | Major Application | agriculture | | InChI | 1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ | | InChIKey | UZKQTCBAMSWPJD-FARCUNLSSA-N | | SMILES | C\C(CO)=C/CNc1ncnc2[nH]cnc12 | | CAS DataBase Reference | 6025-81-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | EM9506000 | | F | 8-10-23 | | Storage Class | 11 - Combustible Solids |
| | ZEATIN Usage And Synthesis |
| Uses | trans-Zeatin Hydrochloride can be used in biological study and therapeutic use for plant-growth factors as cell-proliferating agents for promotion of wound healing. |
| | ZEATIN Preparation Products And Raw materials |
|