- 2-Naphthaleneethanol
-
- $2.00 / 1KG
-
2019-07-06
- CAS:7228-47-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1 ton
|
| | 2-Naphthaleneethanol Basic information |
| Product Name: | 2-Naphthaleneethanol | | Synonyms: | alpha-Methyl-2-naphthalenemethanol
2-(1-Hydroxyethyl)naphthalene;1-(naphthalen-2-yl)ethanol;a-Methyl-2-naphthalenemethanol;2-Naphthalenemethanol, alpha-methyl-;2-(1-HYDROXYETHYL)NAPHTHALENE;2-NAPHTHYL ETHANOL;(+/-)-1-(2-NAPHTHYL)ETHANOL;Methyl 2-naphtylcarbinol | | CAS: | 7228-47-9 | | MF: | C12H12O | | MW: | 172.22 | | EINECS: | 230-630-3 | | Product Categories: | Alcohols;C9 to C30;Oxygen Compounds | | Mol File: | 7228-47-9.mol |  |
| | 2-Naphthaleneethanol Chemical Properties |
| Melting point | 73-78 °C (lit.) | | Boiling point | 180-184 °C (15 mmHg) | | density | 1.113±0.06 g/cm3(Predicted) | | Fp | 170°C/13mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | pka | 14.36±0.20(Predicted) | | form | Powder | | color | White to yellow | | BRN | 1907449 | | InChI | InChI=1S/C12H12O/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9,13H,7-8H2 | | InChIKey | VCZANYLMPFRUHG-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1CCO | | CAS DataBase Reference | 7228-47-9(CAS DataBase Reference) | | NIST Chemistry Reference | «ALPHA»-methyl-2-naphthalenemethanol(7228-47-9) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids |
| | 2-Naphthaleneethanol Usage And Synthesis |
| Uses | 1-(Naphthalen-2-yl)ethanol is a reagent used in the chemical-enzymic preparation and resolution of β-naphthyl alcohols. A cinacalcet impurity. | | General Description | α-Methyl-2-naphthalenemethanol forms complexes and multimers with methyl lactate. α-Methyl-2-naphthalenemethanol on reaction with sulfur trioxide-dimethylformamide complex and pyridine yields sulfated products. |
| | 2-Naphthaleneethanol Preparation Products And Raw materials |
|