| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione Basic information |
| Product Name: | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione | | Synonyms: | 5-(dimethylaminomethylene)-2,2-dimethyl-1,3-dioxa;5-(dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-di;5-(dimethylaminomethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione;omethylidene)-2,2-dimethyl-1,3-dioxane-4;1,3-Dioxane-4,6-dione, 5-[(dimethylamino)methylene]-2,2-dimethyl-;5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione | | CAS: | 75039-60-0 | | MF: | C9H13NO4 | | MW: | 199.2 | | EINECS: | | | Product Categories: | Carbonyl Compounds;Lactones;Organic Building Blocks;Building Blocks;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks | | Mol File: | 75039-60-0.mol |  |
| | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical Properties |
| Melting point | 120-123 °C (lit.) | | Boiling point | 360.1±42.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 3.28±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C9H13NO4/c1-9(2)13-7(11)6(5-10(3)4)8(12)14-9/h5H,1-4H3 | | InChIKey | YKMXFLMJEHHKMU-UHFFFAOYSA-N | | SMILES | CN(C)\C=C1/C(=O)OC(C)(C)OC1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione Usage And Synthesis |
| Uses | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione is a β-dimethyl amino acrylate and its synthesis has been reported. | | General Description | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione is a β-dimethyl amino acrylate and its synthesis has been reported. |
| | 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione Preparation Products And Raw materials |
|