|
|
| | BIS(DIISOPROPYLAMINO)CHLOROPHOSPHINE Basic information |
| | BIS(DIISOPROPYLAMINO)CHLOROPHOSPHINE Chemical Properties |
| Melting point | 100-104 °C(lit.) | | Boiling point | 291℃ | | Fp | 130℃ | | storage temp. | Store under inert gas | | form | Powder | | pka | 4.50±0.70(Predicted) | | color | white to off-white | | Sensitive | air sensitive, moisture sensitive | | InChI | InChI=1S/C12H28ClN2P/c1-9(2)14(10(3)4)16(13)15(11(5)6)12(7)8/h9-12H,1-8H3 | | InChIKey | FEHUTHGOLLQBNW-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(N(C(C)C)C(C)C)Cl | | CAS DataBase Reference | 56183-63-2(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 1 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29310099 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | BIS(DIISOPROPYLAMINO)CHLOROPHOSPHINE Usage And Synthesis |
| Description | Bis(diisopropylamino)chlorophosphine is a white to off-white powder to crystalline organophosphorus compound, mainly used as an organic synthetic raw material or reaction reagent. It can be used in the synthesis of mixed phosphorothioate and methylenephosphine derivatives, etc. It is commonly used in chemical production and laboratory research. | | Chemical Properties | white to light yellow crystal powde | | Uses | Bis(diisopropylamino)chlorophosphine has been used in the synthesis of tert-butyl tetraisopropylphosphorodiamidite ligand for palladium-catalyzed Buchwald–Hartwig amination reaction.
It is also can be used to synthesize:
- acyclic N-phosphonio imine catalyst for selective epoxidations
- boryl-substituted methylenephosphonium derivatives
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling |
| | BIS(DIISOPROPYLAMINO)CHLOROPHOSPHINE Preparation Products And Raw materials |
|