2'-Deoxyadenosine-5'-diphosphate disodium salt manufacturers
|
| | 2'-Deoxyadenosine-5'-diphosphate disodium salt Basic information | | Uses |
| Product Name: | 2'-Deoxyadenosine-5'-diphosphate disodium salt | | Synonyms: | DADP;2'-deoxyadenosine 5'-diphosphate sodium;Adenosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt;2'-DEOXYADENOSINE 5'-DIPHOSPHATE SODIUM SALT;2'-Deoxyadenosine-5'-diphosphate disodium salt;Disodium 5'-dADP;2'-Deoxyadenosine-5'-Diphosphate(dADP),trisodium salt;dADP,2Na | | CAS: | 72003-83-9 | | MF: | C10H13N5Na2O9P2 | | MW: | 455.17 | | EINECS: | 276-280-5 | | Product Categories: | Pharmaceutical | | Mol File: | 72003-83-9.mol |  |
| | 2'-Deoxyadenosine-5'-diphosphate disodium salt Chemical Properties |
| storage temp. | -20°C | | form | Powder | | color | White | | biological source | synthetic (organic) | | Water Solubility | Soluble in water. | | InChI | 1S/C10H15N5O9P2.Na.H/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19;;/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19);; | | InChIKey | KZGAPWRJMWSNQO-UHFFFAOYSA-N | | SMILES | [Na].Nc1ncnc2n(cnc12)C3CC(O)C(COP(O)(=O)OP(O)(O)=O)O3 | | CAS DataBase Reference | 72003-83-9(CAS DataBase Reference) |
| Hazard Codes | T,Xi,Xn | | Risk Statements | 23/24/25-36/37/38-20/21/22 | | Safety Statements | 22-26-36-45-37/39 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2'-Deoxyadenosine-5'-diphosphate disodium salt Usage And Synthesis |
| Uses | 2'-Deoxyadenosine-5'-diphosphate sodium salt is a useful research chemical compound. | | Uses | 2′-Deoxyadenosine 5′-diphosphate (dADP) may be used for the synthesis of deoxyadenylate oligonucleotides with enzymes such as polynucleotide phosphorylase from Escherichia coli. dADP is used as an inhibitor of bacterial poly(A) polymerase. DeoxyADP may be use as an alternative substrate or inhibitor for studies of ATPase and DNA and RNA polymerase specificity. |
| | 2'-Deoxyadenosine-5'-diphosphate disodium salt Preparation Products And Raw materials |
|