- SILICIC ACID
-
- $50.00
-
2026-08-11
- CAS:1343-98-2
- Min. Order: 1KG
- Purity: 99%
|
| | SILICIC ACID Basic information |
| Product Name: | SILICIC ACID | | Synonyms: | SILICIC ACID;SILICA ACID;PRECIPITATED SILICA;Precipiated silica, Hydrated silica;Silica Gel, Indicating, 6-16 mesh, Grade 42;Silica Gel, Amino-3, Modified, Ultrapure;Silica Gel, Davisil Grade 635, 60-100 Mesh, 60;Silica Gel, Davisil Grade 636, 35-60 Mesh, 60 | | CAS: | 1343-98-2 | | MF: | H2O3Si | | MW: | 78.1 | | EINECS: | 215-683-2 | | Product Categories: | Chemical Synthesis;Inorganic Acids;Synthetic Reagents;UVCBs-inorganic;Cosmetic Ingredients & Chemicals;Silica Gels | | Mol File: | 1343-98-2.mol |  |
| | SILICIC ACID Chemical Properties |
| density | 0.230 g/cm3 | | storage temp. | Store at room temperature, keep dry and cool | | form | powder | | color | White | | Odor | Odorless | | Water Solubility | Soluble in water. | | Merck | 13,8564 | | Dielectric constant | 2.0（Ambient） | | Stability: | Stable. | | Cosmetics Ingredients Functions | ANTICAKING
VISCOSITY CONTROLLING
OPACIFYING
ABRASIVE
BULKING
ABSORBENT | | Cosmetic Ingredient Review (CIR) | SILICIC ACID (1343-98-2) | | InChI | InChI=1S/H2O3Si/c1-4(2)3/h1-2H | | InChIKey | IJKVHSBPTUYDLN-UHFFFAOYSA-N | | SMILES | [Si](O)(O)=O | | CAS DataBase Reference | 1343-98-2(CAS DataBase Reference) | | EPA Substance Registry System | Silicic acid (1343-98-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37 | | Safety Statements | 22-26-36-24/25 | | WGK Germany | 3 | | RTECS | VV8853000 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | SILICIC ACID Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Silicic acid hydrate is used for studying neurodegenerative diseases due to its ability to inhibit aluminum uptake. It is utilized for the manufacture catalyst and catalyst carrier. It is involved in tungsten filament production as chemical reagent and flux. Further, it is used for oil and wax decoloring. | | Definition | A colloidal or jellylike hydrated form of silicon(IV) oxide
(SiO2), made by adding an acid (such as hydrochloric acid) to a soluble SILICATE. |
| | SILICIC ACID Preparation Products And Raw materials |
|