| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)BUTANE-1,3-DIONE Basic information |
| Product Name: | 4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)BUTANE-1,3-DIONE | | Synonyms: | 3-(4-FLUOROBENZOYL)-1,1,1-TRIFLUOROACETONE;AKOS B007342;AKOS MSC-0333;4,4,4-Trifluoro-1-(4-fluoro-phenyl)-butane-1,3-;4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)-1,3-BUTANEDIONE;4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)BUTANE-1,3-DIONE;ART-CHEM-BB B007342;4,4,4-Trifluoro-1-(4-fluorophenyl) | | CAS: | 582-65-0 | | MF: | C10H6F4O2 | | MW: | 234.15 | | EINECS: | | | Product Categories: | Phenyls & Phenyl-Het;Phenyls & Phenyl-Het | | Mol File: | 582-65-0.mol |  |
| | 4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)BUTANE-1,3-DIONE Chemical Properties |
| Melting point | 40-42°C | | Boiling point | 257.0±35.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 5.61±0.25(Predicted) | | color | White | | InChI | 1S/C10H6F4O2/c11-7-3-1-6(2-4-7)8(15)5-9(16)10(12,13)14/h1-4H,5H2 | | InChIKey | KEZLARPKXOHKJS-UHFFFAOYSA-N | | SMILES | O=C(CC(C(C=C1)=CC=C1F)=O)C(F)(F)F | | CAS DataBase Reference | 582-65-0 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2914790090 | | Storage Class | 11 - Combustible Solids |
| | 4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)BUTANE-1,3-DIONE Usage And Synthesis |
| Uses | 4,4,4-Trifluoro-1-(4-fluorophenyl)butane-1,3-dioneis an intermediate in the synthesis of Mavacoxib (M197900) which is a long-acting COX-2 Inhibitor and is developed as a veterinary drug used to treat pain and inflammation with degenerative joint disease for dogs. |
| | 4,4,4-TRIFLUORO-1-(4-FLUOROPHENYL)BUTANE-1,3-DIONE Preparation Products And Raw materials |
|