| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Fluoro-3-(trifluoromethyl)aniline Basic information |
| | 2-Fluoro-3-(trifluoromethyl)aniline Chemical Properties |
| Boiling point | 189 °C (lit.) | | density | 1.39 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 180 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | pka | 1.98±0.10(Predicted) | | Specific Gravity | 1.390 | | color | Colourless | | InChI | InChI=1S/C7H5F4N/c8-6-4(7(9,10)11)2-1-3-5(6)12/h1-3H,12H2 | | InChIKey | YKPDYPPZLUZONK-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(C(F)(F)F)=C1F | | CAS DataBase Reference | 123973-25-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | PG3 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HazardClass | IRRITANT | | HazardClass | 6.1 | | HS Code | 29214300 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Fluoro-3-(trifluoromethyl)aniline Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 2-Fluoro-3-(trifluoromethyl)aniline is a buliding block for various inhibitors such as 5,6,7-Trimethoxy-N-phenyl(ethyl)-4-aminoquinazoline derivatives that have anticancer activities and N-[3-(Phenylcarbamoyl)aryl]pyrimidine-5-carboxamide that are lymphocyte-specific kinase inhibitors. | | Uses | 2-Fluoro-3-(trifluoromethyl)aniline may be used in chemical synthesis. |
| | 2-Fluoro-3-(trifluoromethyl)aniline Preparation Products And Raw materials |
|