| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl beta-carboline-3-carboxylate Basic information |
| Product Name: | Ethyl beta-carboline-3-carboxylate | | Synonyms: | β-cce;β-CCE, Ethyl 9H-pyrido[3,4-b]indole-3-carboxylate;Ro 15-2538;Ethyl b-Carboline-3-carboxylate;BETA-CCE;BETA-CARBOLINE-3-CARBOXYLIC ACID ETHYL ESTER;ETHYL 9 H-PYRIDO[3,4-B]INDOLE-3-CARBOXYLATE;beta-carboline-3-carboxylate ethyl | | CAS: | 74214-62-3 | | MF: | C14H12N2O2 | | MW: | 240.26 | | EINECS: | | | Product Categories: | | | Mol File: | 74214-62-3.mol |  |
| | Ethyl beta-carboline-3-carboxylate Chemical Properties |
| Melting point | 228-230 °C (lit.) | | Boiling point | 470.9±25.0 °C(Predicted) | | density | 1.308±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly) | | form | Solid | | pka | 14.49±0.40(Predicted) | | color | Pale Beige to Light Brown | | Merck | 13,3814 | | InChI | 1S/C14H12N2O2/c1-2-18-14(17)12-7-10-9-5-3-4-6-11(9)16-13(10)8-15-12/h3-8,16H,2H2,1H3 | | InChIKey | KOVRZNUMIKACTB-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cc2c(cn1)[nH]c3ccccc23 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | RN7092000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Ethyl beta-carboline-3-carboxylate Usage And Synthesis |
| Uses | Ethyl b-Carboline-3-carboxylate (b-CCE) is an inverse agonist of benzodiazepine activity. Negative modulator at benzodiazepine sites. | | Definition | ChEBI: 9H-pyrido[3,4-b]indole-3-carboxylic acid ethyl ester is a member of beta-carbolines. |
| | Ethyl beta-carboline-3-carboxylate Preparation Products And Raw materials |
|