CYCLOPENTADECANOLIDE manufacturers
- pentadecanolide
-
- $50.00 / 1kg
-
2025-05-23
- CAS:32539-85-8
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 5000
|
| | CYCLOPENTADECANOLIDE Basic information |
| Product Name: | CYCLOPENTADECANOLIDE | | Synonyms: | FEMA 2840;15-PENTADECANOLACTONE;15-Methyloxacyclopentadecan-2-one;Oxacyclopentadecan-2-one, 15-methyl-;PENTADECANO-1,14-LACTONE;14-Hydroxypentadecanoic acid 1,14-lactone;15-Methyl-1-oxacyclopentadecane-2-one;W-PENTADECALACTONE | | CAS: | 32539-85-8 | | MF: | C15H28O2 | | MW: | 240.38 | | EINECS: | 203-354-6 | | Product Categories: | | | Mol File: | 32539-85-8.mol |  |
| | CYCLOPENTADECANOLIDE Chemical Properties |
| Melting point | 34-38 °C(lit.) | | Boiling point | 137 °C2 mm Hg(lit.) | | density | 0.918 g/mL at 25 °C(lit.) | | Fp | >230 °F | | JECFA Number | 239 | | InChI | InChI=1S/C15H28O2/c1-14-12-10-8-6-4-2-3-5-7-9-11-13-15(16)17-14/h14H,2-13H2,1H3 | | InChIKey | LVECZGHBXXYWBO-UHFFFAOYSA-N | | SMILES | O1C(C)CCCCCCCCCCCCC1=O | | LogP | 5.175 (est) |
| Safety Statements | 24/25 | | WGK Germany | 1 | | RTECS | RN9775000 |
| | CYCLOPENTADECANOLIDE Usage And Synthesis |
| | CYCLOPENTADECANOLIDE Preparation Products And Raw materials |
|