| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | Bn-OPT, Dudley Reagent Basic information |
| Product Name: | Bn-OPT, Dudley Reagent | | Synonyms: | 2-Benzyloxy-1-methylpyridinium triflate;Bn-OPT, Dudley Reagent;2-Benzyloxy-1-methylpyridinium Trifluoromethanesulfonate;1-Methyl-2-(phenylmethoxy)-pyridinium 1,1,1-trifluoromethanesulfonate;2-Benzyloxy-1-methylpyridinium Trifluoromethanesulfonate (This product is only available in Japan.);2-Benzyloxy-1-methylpyridinium triflate 96%;Dudley's reagent;Bn-OPT | | CAS: | 882980-43-0 | | MF: | C14H14F3NO4S | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 882980-43-0.mol |  |
| | Bn-OPT, Dudley Reagent Chemical Properties |
| Melting point | 85-91 °C | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H14NO.CHF3O3S/c1-14-10-6-5-9-13(14)15-11-12-7-3-2-4-8-12;2-1(3,4)8(5,6)7/h2-10H,11H2,1H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | DUXHYQYOPHEFGC-UHFFFAOYSA-M | | SMILES | [O-]S(=O)(=O)C(F)(F)F.C[n+]1ccccc1OCc2ccccc2 | | CAS DataBase Reference | 882980-43-0 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | Bn-OPT, Dudley Reagent Usage And Synthesis |
| Uses | Dudley Reagents
- Novel reagent for benzyl protection of alcohols under neutral conditions. Promotes selective formation of benzyl esters of carboxylic acids in presence of triethylamine.
|
| | Bn-OPT, Dudley Reagent Preparation Products And Raw materials |
|