|
|
| | 1-(2-Phenylethyl)-1H-imidazole Basic information |
| Product Name: | 1-(2-Phenylethyl)-1H-imidazole | | Synonyms: | 1-(2-Phenylethyl)-1H-imidazole;1-Phenethylimidazole;1H-Imidazole,1-(2-phenylethyl)-;1-phenethyl-1H-imidazole;1-Phenethylimidazole/1-(2-Phenylethyl)-1H-imidazole;Alcaftadine Impurity 8;1-Phenethylimidazole>;Alcaftadine Impurity 7 (1-Phenethylimidazole) | | CAS: | 49823-14-5 | | MF: | C11H12N2 | | MW: | 172.23 | | EINECS: | 805-891-7 | | Product Categories: | | | Mol File: | 49823-14-5.mol |  |
| | 1-(2-Phenylethyl)-1H-imidazole Chemical Properties |
| Melting point | 32.0 to 36.0 °C | | Boiling point | 145°C/0.2mmHg(lit.) | | density | 1.02 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | pka | 7.04±0.10(Predicted) | | form | powder to lump | | color | White to Light yellow | | InChI | InChI=1S/C11H12N2/c1-2-4-11(5-3-1)6-8-13-9-7-12-10-13/h1-5,7,9-10H,6,8H2 | | InChIKey | SSENHTOBLYRWKU-UHFFFAOYSA-N | | SMILES | C1N(CCC2=CC=CC=C2)C=CN=1 |
| | 1-(2-Phenylethyl)-1H-imidazole Usage And Synthesis |
| Chemical Properties | Light yellow oily solid or liquid | | Uses | 1-Phenethylimidazole, is a N-substituted imidazole derivative, which has been shown to act as an inhibitor of nitric oxide synthase. |
| | 1-(2-Phenylethyl)-1H-imidazole Preparation Products And Raw materials |
|