| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(4-Methylphenoxy)benzoic acid Basic information |
| Product Name: | 4-(4-Methylphenoxy)benzoic acid | | Synonyms: | 4-(P-TOLYLOXY)BENZOIC ACID;4-(4-Methylphenoxy)benzoic acid 97%;JR-7129, 4-(p-Tolyloxy)benzoic acid, 97%;Benzoic acid, 4-(4-methylphenoxy)-;4-(4-methylphenoxy)benzenemacetic acid;4-(4-Methylphenoxy)benzoic acid | | CAS: | 21120-65-0 | | MF: | C14H12O3 | | MW: | 228.24 | | EINECS: | | | Product Categories: | | | Mol File: | 21120-65-0.mol |  |
| | 4-(4-Methylphenoxy)benzoic acid Chemical Properties |
| Melting point | 178-182 °C | | Boiling point | 375.3±25.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 4.36±0.10(Predicted) | | InChI | 1S/C14H12O3/c1-10-2-6-12(7-3-10)17-13-8-4-11(5-9-13)14(15)16/h2-9H,1H3,(H,15,16) | | InChIKey | DCDYPMNXCDXNJZ-UHFFFAOYSA-N | | SMILES | Cc1ccc(Oc2ccc(cc2)C(O)=O)cc1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-50/53 | | Safety Statements | 26-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | 9 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |
| | 4-(4-Methylphenoxy)benzoic acid Usage And Synthesis |
| | 4-(4-Methylphenoxy)benzoic acid Preparation Products And Raw materials |
|