| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl 3,5-difluorobenzoylformate Basic information |
| Product Name: | Ethyl 3,5-difluorobenzoylformate | | Synonyms: | ETHYL 3,5-DIFLUOROPHENYLGLYOXYLATE;Ethyl 3,5-difluorobenzoylforMate,96%;ethyl 2-(3,5-difluorophenyl)-2-oxoacetate;3,5-Difluoro-oxo-benzeneacetic acid ethyl ester;Benzeneacetic acid, 3,5-difluoro-α-oxo-, ethyl ester;2-(3,5-difluorophenyl)-2-oxoacetic acid ethyl ester;Ethyl 3,5-difluorobenzoylformate | | CAS: | 208259-57-8 | | MF: | C10H8F2O3 | | MW: | 214.17 | | EINECS: | | | Product Categories: | | | Mol File: | 208259-57-8.mol |  |
| | Ethyl 3,5-difluorobenzoylformate Chemical Properties |
| Boiling point | 247.4 °C(lit.) | | density | 1.27 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.482(lit.) | | Fp | 66 °C | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C10H8F2O3/c1-2-15-10(14)9(13)6-3-7(11)5-8(12)4-6/h3-5H,2H2,1H3 | | InChIKey | JPTHBXHXKOKMTE-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(=O)c1cc(F)cc(F)c1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Ethyl 3,5-difluorobenzoylformate Usage And Synthesis |
| | Ethyl 3,5-difluorobenzoylformate Preparation Products And Raw materials |
|