|
|
| | Diazald-N-methyl-13C-N-methyl-d3 Basic information |
| Product Name: | Diazald-N-methyl-13C-N-methyl-d3 | | Synonyms: | N-METHYL-13C-D3-N-NITROSO-P-TOLUENESULFONAMIDE;Diazald-N-methyl-13C-N-methyl-d3;DIAZALD(R)-N-METHYL-13C-N-METHYL-D3;DIAZALD-N-METHYL-13C-N-METHYL-D3, 99 ATO M % 13C, 99 ATOM % D;Diazald?-(N-methyl-13C,d3) | | CAS: | 102832-11-1 | | MF: | C8H7D3N2O3S | | MW: | 218.27 | | EINECS: | | | Product Categories: | | | Mol File: | 102832-11-1.mol |  |
| | Diazald-N-methyl-13C-N-methyl-d3 Chemical Properties |
| Melting point | 62°C | | storage temp. | -20°C | | form | solid | | InChI | 1S/C8H10N2O3S/c1-7-3-5-8(6-4-7)14(12,13)10(2)9-11/h3-6H,1-2H3/i2+1D3 | | InChIKey | FFKZOUIEAHOBHW-JVXUGDAPSA-N | | SMILES | [2H][13C]([2H])([2H])N(N=O)S(=O)(=O)c1ccc(C)cc1 |
| Hazard Codes | Xn,Xi,E | | Risk Statements | 20/21/22-43-36/37/38-2 | | Safety Statements | 26-27-36/37/39-36/37-35-15 | | RIDADR | UN3234 - UN3224 DOT class 4.1 (N-Methyl-N-nitroso-p-methylbenzenesulfonamide) Self-reactive solid type C, temperature controlled) | | WGK Germany | 2 | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | Diazald-N-methyl-13C-N-methyl-d3 Usage And Synthesis |
| | Diazald-N-methyl-13C-N-methyl-d3 Preparation Products And Raw materials |
|