- o-Xylene-d10
-
- $0.00 / 5mg
-
2026-03-13
- CAS:56004-61-6
- Min. Order:
- Purity:
- Supply Ability: 10g
- O-XYLENE-D10
-
- $1.00 / 1KG
-
2020-01-13
- CAS:56004-61-6
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | O-XYLENE-D10 Basic information |
| Product Name: | O-XYLENE-D10 | | Synonyms: | O-XYLENE-D10;(2H10)-o-xylene;O-XYLENE-D10, 99+ ATOM % D;O-XYLENE-D10 99.3%;o-Xylene-d10,for NMR,99+ atom % D;o-Xylene-d10, 98+% (Isotopic);Benzene-1,2,3,4-d4, 5,6-di(methyl-d3)-;1,2-dimethylbenzene-d10 | | CAS: | 56004-61-6 | | MF: | C8D10 | | MW: | 116.23 | | EINECS: | 259-942-8 | | Product Categories: | | | Mol File: | 56004-61-6.mol |  |
| | O-XYLENE-D10 Chemical Properties |
| Melting point | -25 °C | | Boiling point | 142 °C(lit.) | | density | 0.953 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5016(lit.) | | Fp | 90 °F | | storage temp. | Flammables area | | form | Liquid | | color | Colorless | | Sensitive | Moisture Sensitive | | Merck | 14,10081 | | InChI | 1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D | | InChIKey | CTQNGGLPUBDAKN-ZGYYUIRESA-N | | SMILES | [2H]c1c([2H])c([2H])c(c(c1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 10-20/21-38 | | Safety Statements | 23-25 | | RIDADR | UN 1307 3/PG 3 | | WGK Germany | 2 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 3 Asp. Tox. 1 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | O-XYLENE-D10 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | O-Xylene-d10 is a labeled Xylene, intended for use as an internal standard for the quantification of Xylene by GC- or LC-mass spectrometry. | | General Description | o-Xylene-d10 is a deuterated derivative of o-xylene. It has an isotopic purity of 99atom%D. It participates as an internal standard during the quantification of volatile organic compounds (furan, chloroform, benzene, trichloroethene, toluene and styrene) by vacuum distillation coupled with gas chromatography/mass spectrometry. |
| | O-XYLENE-D10 Preparation Products And Raw materials |
|