| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:TRIMESITYLBORANE
CAS:7297-95-2
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:Trimesitylborane
CAS:7297-95-2
Remarks:SR19030042
|
|
| | TRIMESITYLBORANE Basic information |
| | TRIMESITYLBORANE Chemical Properties |
| Melting point | 193-195 °C (lit.) | | Boiling point | 477.6±45.0 °C(Predicted) | | density | 0.98±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C27H33B/c1-16-10-19(4)25(20(5)11-16)28(26-21(6)12-17(2)13-22(26)7)27-23(8)14-18(3)15-24(27)9/h10-15H,1-9H3 | | InChIKey | FXFWLXFJBVILBE-UHFFFAOYSA-N | | SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c3c(C)cc(C)cc3C)c(C)c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TRIMESITYLBORANE Usage And Synthesis |
| Uses | Reactant involved in:
- Synthesis of sandwich complex of trimesitylborane and fluoroborate and cyanoborate derivatives
- Investigations of reactivity of aryldimesitylboranes under Suzuki-Miyaura coupling conditions
- Laser desorption ionization mass spectrometry investigations
- Studies of ion conductive characteristics of boron stabilized carbanions
| | reaction suitability | reagent type: reductant |
| | TRIMESITYLBORANE Preparation Products And Raw materials |
|