| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic acid diphenyl ester Basic information |
| | (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic acid diphenyl ester Chemical Properties |
| Melting point | 84°C | | Boiling point | 497.0±28.0 °C(Predicted) | | density | 1.45 | | solubility | slightly sol. in Methanol | | form | powder to crystal | | pka | -7.91±0.20(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C19H14NO4PS/c21-25(23-15-9-3-1-4-10-15,24-16-11-5-2-6-12-16)20-17-13-7-8-14-18(17)22-19(20)26/h1-14H | | InChIKey | POSVXIWJQXSIIP-UHFFFAOYSA-N | | SMILES | P(N1C2=CC=CC=C2OC1=S)(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| Safety Statements | 22-24/25 | | HS Code | 2934.99.4400 |
| | (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic acid diphenyl ester Usage And Synthesis |
| | (2,3-Dihydro-2-thioxo-3-benzoxazolyl)phosphonic acid diphenyl ester Preparation Products And Raw materials |
|