|
|
| | Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid Basic information |
| | Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid Chemical Properties |
| Boiling point | 333.7±37.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.57±0.20(Predicted) | | InChI | 1S/C7H11NO3/c8-6-4-2-1-3(11-4)5(6)7(9)10/h3-6H,1-2,8H2,(H,9,10)/t3-,4+,5-,6+/m1/s1 | | InChIKey | IBJRDBSWQMNJKY-MOJAZDJTSA-N | | SMILES | O=C(O)[C@@H]1[C@@H](CC2)O[C@@H]2[C@@H]1N |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid Usage And Synthesis |
| | Diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylic acid Preparation Products And Raw materials |
|