- DIPSO sodium salt
-
-
2026-08-14
- CAS:102783-62-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 3500kg/month
- DIPSO sodium salt
-
-
2024-04-12
- CAS:102783-62-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
|
| | 3-[N,N-Bis(hydroxyethyl)amino]-2-hydroxypropanesulphonic acid sodium salt Basic information |
| | 3-[N,N-Bis(hydroxyethyl)amino]-2-hydroxypropanesulphonic acid sodium salt Chemical Properties |
| solubility | water: 0.333 g/L, clear to slightly hazy, colorless | | form | crystalline powder | | pka | 7.6(at 25℃) | | PH Range | 7.0 - 8.2 | | PH | 7.0-8.2 | | Water Solubility | water: 0.333g/L, clear to slightly hazy, colorless | | Major Application | diagnostic assay manufacturing | | InChI | InChI=1S/C7H17NO6S.Na.H/c9-3-1-8(2-4-10)5-7(11)6-15(12,13)14;;/h7,9-11H,1-6H2,(H,12,13,14);; | | InChIKey | HKDXASRFOMXBGO-UHFFFAOYSA-N | | SMILES | N(CCO)(CCO)CC(O)CS(O)(=O)=O.[NaH] | | CAS DataBase Reference | 102783-62-0(CAS DataBase Reference) |
| Hazard Codes | F,Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 7/9-16-26-36 | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | 3-[N,N-Bis(hydroxyethyl)amino]-2-hydroxypropanesulphonic acid sodium salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | diagnostic assay manufacturing |
| | 3-[N,N-Bis(hydroxyethyl)amino]-2-hydroxypropanesulphonic acid sodium salt Preparation Products And Raw materials |
|