| Company Name: |
ChemeGen Gold |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
Griseofulvic acid manufacturers
- Griseofulvic acid
-
- $1.00
-
2026-08-07
- CAS:469-54-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KG
|
| | Griseofulvic acid Basic information |
| | Griseofulvic acid Chemical Properties |
| Melting point | 260-262°C (dec.) | | Boiling point | 562.7±50.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 7.52±0.40(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C16H15ClO6/c1-7-4-8(18)5-11(19)16(7)15(20)12-9(21-2)6-10(22-3)13(17)14(12)23-16/h6-7H,4-5H2,1-3H3/t7-,16+/m1/s1 | | InChIKey | YIQRSAKVWZVLDN-QZTNRIJFSA-N | | SMILES | C1C(OC)=C2C(=O)[C@]3(C(=O)CC(=O)C[C@H]3C)OC2=C(Cl)C=1OC |
| | Griseofulvic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A newly metabolite of Griseofulvin (G787500). |
| | Griseofulvic acid Preparation Products And Raw materials |
|