| Company Name: |
ChemeGen Gold |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
|
| | 6-demethylgriseofulvin Basic information |
| Product Name: | 6-demethylgriseofulvin | | Synonyms: | 6-demethylgriseofulvin;(2S,6'R)-7-Chloro-6-hydroxy-2',4-dimethoxy-6'-methylspiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione;6-Desmethylgriseofulvin;6-O-DeMethyl Griseofulvin;(1'S,6'R)-7-Chloro-6-hydroxy-2',6-diMethoxy-6'-Methylspiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione;(1'S-trans)- 7-Chloro-6-hydroxy-2',6-diMethoxy-6'-Methylspiro
[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione;Griseofulvin Impurity 1;Griseofulvin 6-O-Demethyl Impurity | | CAS: | 20168-88-1 | | MF: | C16H15ClO6 | | MW: | 338.74 | | EINECS: | | | Product Categories: | Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Aromatics, Chiral Reagents, Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 20168-88-1.mol |  |
| | 6-demethylgriseofulvin Chemical Properties |
| Melting point | >260°C (dec.) | | Boiling point | 600.8±55.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 5.31±0.60(Predicted) | | form | Solid | | color | Off-White to Pale Red | | InChI | InChI=1S/C16H15ClO6/c1-7-4-8(18)5-11(22-3)16(7)15(20)12-10(21-2)6-9(19)13(17)14(12)23-16/h5-7,19H,4H2,1-3H3 | | InChIKey | SYNGDIBHUPXIQA-UHFFFAOYSA-N | | SMILES | O1C2=C(Cl)C(O)=CC(OC)=C2C(=O)C21C(C)CC(=O)C=C2OC |
| | 6-demethylgriseofulvin Usage And Synthesis |
| Uses | A metabolite of Griseofulvin (G787500). |
| | 6-demethylgriseofulvin Preparation Products And Raw materials |
|