|
|
| | 5-Bromo-2-pyridin-3-yl-1,3-benzoxazole Basic information |
| | 5-Bromo-2-pyridin-3-yl-1,3-benzoxazole Chemical Properties |
| form | solid | | InChI | 1S/C12H7BrN2O/c13-9-3-4-11-10(6-9)15-12(16-11)8-2-1-5-14-7-8/h1-7H | | InChIKey | XXVXIUHYSJGBIB-UHFFFAOYSA-N | | SMILES | Brc1ccc2oc(nc2c1)-c3cccnc3 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 5-Bromo-2-pyridin-3-yl-1,3-benzoxazole Usage And Synthesis |
| | 5-Bromo-2-pyridin-3-yl-1,3-benzoxazole Preparation Products And Raw materials |
|