|
|
| | 4-Amino-7-methoxy-2-methylquinoline Basic information |
| | 4-Amino-7-methoxy-2-methylquinoline Chemical Properties |
| form | solid | | InChI | 1S/C11H12N2O/c1-7-5-10(12)9-4-3-8(14-2)6-11(9)13-7/h3-6H,1-2H3,(H2,12,13) | | InChIKey | DFEFIEPUGGZAFP-UHFFFAOYSA-N | | SMILES | NC1=CC(C)=NC2=CC(OC)=CC=C21 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Amino-7-methoxy-2-methylquinoline Usage And Synthesis |
| | 4-Amino-7-methoxy-2-methylquinoline Preparation Products And Raw materials |
|