| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(Dioxalan-2-yl-methyl)-tributylphosphonium bromide manufacturers
|
| | (Dioxalan-2-yl-methyl)-tributylphosphonium bromide Basic information |
| Product Name: | (Dioxalan-2-yl-methyl)-tributylphosphonium bromide | | Synonyms: | ((1,3-Dioxolan-2-yl)methyl)tributylphosphonium bromide;Phosphonium, tributyl(1,3-dioxolan-2-ylmethyl)-, bromide (1:1);tributyl(1,3-dioxolan-2-ylmethyl)phosphanium;Phosphonium, tributyl(1,3-dioxolan-2-ylmethyl)-, bromide;tributyl(1,3-dioxolan-2-ylmethyl)phosphanium bromide;((1,3-Dioxolan-2-yl)methyl)tributylphosphonium bromide - [D88312];Tributyl(1,3-dioxolan-2-ylmethyl)phosphonium Bromide;(Dioxalan-2-yl-methyl)-tributylphosphonium bromide | | CAS: | 115754-62-6 | | MF: | C16H34BrO2P | | MW: | 369.32 | | EINECS: | | | Product Categories: | | | Mol File: | 115754-62-6.mol |  |
| | (Dioxalan-2-yl-methyl)-tributylphosphonium bromide Chemical Properties |
| Melting point | 25-40 °C | | storage temp. | Inert atmosphere,2-8°C | | form | powder to lump | | color | White to Yellow to Orange | | InChI | 1S/C16H34O2P.BrH/c1-4-7-12-19(13-8-5-2,14-9-6-3)15-16-17-10-11-18-16;/h16H,4-15H2,1-3H3;1H/q+1;/p-1 | | InChIKey | SABIECHYMHKXJI-UHFFFAOYSA-M | | SMILES | [Br-].CCCC[P+](CCCC)(CCCC)CC1OCCO1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2932.99.9090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (Dioxalan-2-yl-methyl)-tributylphosphonium bromide Usage And Synthesis |
| reaction suitability | reaction type: C-C Bond Formation |
| | (Dioxalan-2-yl-methyl)-tributylphosphonium bromide Preparation Products And Raw materials |
|