| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (4S,4aS,8aS)-4-Phenyldecahydro-4-quinolinol Basic information |
| Product Name: | (4S,4aS,8aS)-4-Phenyldecahydro-4-quinolinol | | Synonyms: | (4S,4aS,8aS)-4-phenyldecahydro-4-quinolinol(SALTDATA: FREE);rac-(4S,4aS,8aS)-4-phenyldecahydro-4-quinolinol;4-Quinolinol, decahydro-4-phenyl-, (4R,4aR,8aR)-rel-;(4S,4aS,8aS)-4-phenyldecahydroquinolin-4-ol;(4S,4aS,8aS)-4-Phenyldecahydro-4-quinolinol | | CAS: | 465536-44-1 | | MF: | C15H21NO | | MW: | 231.33 | | EINECS: | | | Product Categories: | | | Mol File: | 465536-44-1.mol |  |
| | (4S,4aS,8aS)-4-Phenyldecahydro-4-quinolinol Chemical Properties |
| Boiling point | 382.970±42.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.081±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 13.984±0.20(predicted) | | form | solid | | InChI | 1S/C15H21NO/c17-15(12-6-2-1-3-7-12)10-11-16-14-9-5-4-8-13(14)15/h1-3,6-7,13-14,16-17H,4-5,8-11H2/t13-,14-,15+/m0/s1 | | InChIKey | JENIXYWBDVSBMO-SOUVJXGZSA-N | | SMILES | O[C@]1(C2=CC=CC=C2)[C@@H](CCCC3)[C@H]3NCC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (4S,4aS,8aS)-4-Phenyldecahydro-4-quinolinol Usage And Synthesis |
| | (4S,4aS,8aS)-4-Phenyldecahydro-4-quinolinol Preparation Products And Raw materials |
|