| Company Name: |
Tetranov Biopharm
|
| Tel: |
13526569071 |
| Email: |
sales@leadmedpharm.com |
| Products Intro: |
Product Name:tert-butyl 5-bromo-3-methyl-1H-indazole-1-carboxylate
CAS:552331-49-4
Purity:95% Package:1g;5g;25g;100g
|
|
| | 1-BOC-5-BROMO-INDAZOLE Basic information |
| Product Name: | 1-BOC-5-BROMO-INDAZOLE | | Synonyms: | N-BOC-5-BROMO INDAZOLE;tert-butyl 5-bromo-3-methyl-1H-indazole-1-carboxylate;5-Bromo-3-methyl-indazole-1-carboxylic acid tert-butyl ester;1-BOC-5-BROMO-3-METHYL-1H-INDAZOLE;1H-Indazole-1-carboxylic acid, 5-bromo-3-methyl-, 1,1-dimethylethyl ester;N-Boc-5-bromoindazole;5-bromo-3-methyl-1H-indoleazole-1-macetic acidtertbutyl ester | | CAS: | 552331-49-4 | | MF: | C13H15BrN2O2 | | MW: | 311.17 | | EINECS: | | | Product Categories: | | | Mol File: | 552331-49-4.mol |  |
| | 1-BOC-5-BROMO-INDAZOLE Chemical Properties |
| Boiling point | 393.5±34.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -1.91±0.50(Predicted) | | form | solid | | Appearance | White to light brown Solid | | InChI | 1S/C12H13BrN2O2/c1-12(2,3)17-11(16)15-10-5-4-9(13)6-8(10)7-14-15/h4-7H,1-3H3 | | InChIKey | CAQGDWLRIQCXSP-UHFFFAOYSA-N | | SMILES | BrC1=CC=C2N(C(OC(C)(C)C)=O)N=CC2=C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-BOC-5-BROMO-INDAZOLE Usage And Synthesis |
| | 1-BOC-5-BROMO-INDAZOLE Preparation Products And Raw materials |
|