| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
DMEOB manufacturers
- DMeOB
-
- $30.00
-
2026-04-22
- CAS:40252-74-2
- Purity: 99.84%
- Supply Ability: 10g
|
| Product Name: | DMEOB | | Synonyms: | DMEOB;[(3-METHOXYPHENYL)METHYLENE]HYDRAZONE-3-METHOXYBENZALDEHYDE;3-METHOXYBENZALDEHYDE [(3-METHOXYPHENYL)METHYLENE]HYDRAZONE;bis(3-methoxybenzylidene)hydrazine;Benzaldehyde, 3-methoxy-, 2-[(3-methoxyphenyl)methylene]hydrazone;1,2-Bis(3-methoxybenzylidene)hydrazine;DMeOB, 10 mM in DMSO | | CAS: | 40252-74-2 | | MF: | C16H16N2O2 | | MW: | 268.31 | | EINECS: | | | Product Categories: | Glutamate receptor | | Mol File: | 40252-74-2.mol |  |
| | DMEOB Chemical Properties |
| Melting point | 77-78 °C(Solv: ethanol (64-17-5)) | | Boiling point | 405.1±45.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | H2O: insoluble | | form | solid | | pka | 6.46±0.50(Predicted) | | color | yellow | | InChI | 1S/C16H16N2O2/c1-19-15-7-3-5-13(9-15)11-17-18-12-14-6-4-8-16(10-14)20-2/h3-12H,1-2H3/b17-11+,18-12+ | | InChIKey | FBNPHFBYHYNMHC-JYFOCSDGSA-N | | SMILES | COc1cccc(\C=N\N=C\c2cccc(OC)c2)c1 |
| Hazard Codes | Xi,N | | Risk Statements | 41-50/53 | | Safety Statements | 26-36/37/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Dam. 1 |
| | DMEOB Usage And Synthesis |
| Uses | DMEOB is a negative allosteric modulator at mGluR-5 (1). These mGlu receptors maintain a modulatory role and act as drug targets for various neurological disorders including depression, schizophrenia and Parkinson’s. | | Biological Activity | Negative allosteric modulator of the metabotropic glutamate receptor mGlu 5 ; displays reversible non-competitive inhibition of mGlu 5 -mediated responses (IC 50 = 3 μ M). | | Biochem/physiol Actions | Negative allosteric modulator at the metabotropic glutamate receptor mGluR5. |
| | DMEOB Preparation Products And Raw materials |
|