| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | Nsc175383 Basic information |
| Product Name: | Nsc175383 | | Synonyms: | Nsc175383;2-((1r,4r)-4-acetaMidocyclohexyl)acetic acid;trans-4-Acetamidocyclohexaneacetic acid;Cyclohexaneacetic acid, 4-(acetylamino)-, trans-;Cariprazine intermediate 1;trans-2-(4-acetamidocyclohexyl)acetic acid;Cariprazine intermed | | CAS: | 2901-44-2 | | MF: | C10H17NO3 | | MW: | 199.25 | | EINECS: | | | Product Categories: | intermediate | | Mol File: | 2901-44-2.mol |  |
| | Nsc175383 Chemical Properties |
| Melting point | 237-239 °C(Solvent: Dimethylformamide) | | Boiling point | 441.1±14.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 4.72±0.10(Predicted) | | InChI | InChI=1S/C10H17NO3/c1-7(12)11-9-4-2-8(3-5-9)6-10(13)14/h8-9H,2-6H2,1H3,(H,11,12)(H,13,14)/t8-,9- | | InChIKey | WFVBDJQHTIBXHZ-KYZUINATSA-N | | SMILES | [C@@H]1(CC(O)=O)CC[C@@H](NC(C)=O)CC1 |
| | Nsc175383 Usage And Synthesis |
| | Nsc175383 Preparation Products And Raw materials |
|