|
|
| | O,O'-Dioctadecylpentaerythritol bis(phosphite) Basic information |
| Product Name: | O,O'-Dioctadecylpentaerythritol bis(phosphite) | | Synonyms: | -2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;3,9-Bis(octadecyloxy);Distearylpentaerythritol Diphosphite;Distearyl Pentaerythrityl Diphsophite;Weston 618;2,4,8,10-Tetraoxa-3,9-diphosphaspiro5.5undecane, 3,9-bis(octadecyloxy)-;CYCLICNEOPENTANETETRAYLBIS(OCTADECYLPHOSPHITE);AO-118 | | CAS: | 3806-34-6 | | MF: | C41H82O6P2 | | MW: | 733.03 | | EINECS: | 223-276-6 | | Product Categories: | Polymer Additives;Polymer Science;Stabilizers | | Mol File: | 3806-34-6.mol |  |
| | O,O'-Dioctadecylpentaerythritol bis(phosphite) Chemical Properties |
| Melting point | 44-47 °C(lit.) | | Boiling point | 692.2±55.0 °C(Predicted) | | density | 1.05[at 20℃] | | vapor pressure | 0Pa at 25℃ | | Fp | >230 °F | | storage temp. | 2-8°C | | form | solid | | Water Solubility | 330ng/L at 25℃ | | InChI | InChI=1S/C41H82O6P2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42-48-44-37-41(38-45-48)39-46-49(47-40-41)43-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-40H2,1-2H3 | | InChIKey | PZRWFKGUFWPFID-UHFFFAOYSA-N | | SMILES | C1C2(COP(OCCCCCCCCCCCCCCCCCC)OC2)COP(OCCCCCCCCCCCCCCCCCC)O1 | | LogP | 16.4 at 25℃ | | EPA Substance Registry System | 2,4,8,10-Tetraoxa-3,9-diphosphaspiro[5.5]undecane, 3,9-bis(octadecyloxy)- (3806-34-6) |
| | O,O'-Dioctadecylpentaerythritol bis(phosphite) Usage And Synthesis |
| Chemical Properties | White waxy solid. Melting point 54-56°C, relative density 0.940-0.960 (50/15.5°C), refractive index 1.4610-1.4660 (50°C). Solubility (g/100g of solvent, 25℃): benzene 14.7, hashane 0.3, chloroform 45.0, acetone 0.3, methanol 0.3; insoluble in water. | | Uses | Color stabilizer for polymers | | General Description | 3,9-Bis(octadecyloxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane is a diphosphaspiro compound which contains two phosphorus atoms and can be used as an antioxidant and as a reducing agent. | | Flammability and Explosibility | Non flammable |
| | O,O'-Dioctadecylpentaerythritol bis(phosphite) Preparation Products And Raw materials |
|