Tert-butyl2-(piperazin-1-yl)acetate manufacturers
|
| | Tert-butyl2-(piperazin-1-yl)acetate Basic information |
| Product Name: | Tert-butyl2-(piperazin-1-yl)acetate | | Synonyms: | Tert-butyl2-(piperazin-1-yl)acetate;tert-Butyl 2-(1-Piperazinyl)acetate;1-Piperazineacetic acid, 1,1-dimethylethyl ester;2-Methyl-2-propanyl 1-piperazinylacetate;1-azineacetic acidtertbutyl ester | | CAS: | 112257-22-4 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | | | Product Categories: | | | Mol File: | 112257-22-4.mol |  |
| | Tert-butyl2-(piperazin-1-yl)acetate Chemical Properties |
| Boiling point | 275.4±25.0 °C(Predicted) | | density | 0.998±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.94±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)8-12-6-4-11-5-7-12/h11H,4-8H2,1-3H3 | | InChIKey | JOJBGPBSHQZRDA-UHFFFAOYSA-N | | SMILES | N1(CC(OC(C)(C)C)=O)CCNCC1 |
| | Tert-butyl2-(piperazin-1-yl)acetate Usage And Synthesis |
| | Tert-butyl2-(piperazin-1-yl)acetate Preparation Products And Raw materials |
|