|
|
| | Ethylene-d4 carbonate Basic information |
| Product Name: | Ethylene-d4 carbonate | | Synonyms: | Ethylene carbonate-d4;1,3-Dioxolan-2-one-4,4,5,5-d4;4,4,5,5-tetradeuterio-1,3-dioxolan-2-one;ETHYLENE CARBONATE (D4, 98%);Ethylene carbonate-d4;Ethylene carbonate (D?, 98%);Deuterated ethylene carbonate;Ethylene-d4 carbonate | | CAS: | 362049-63-6 | | MF: | C3D4O3 | | MW: | 92.09 | | EINECS: | | | Product Categories: | Heterocycles, Isotope Labelled Compounds;Alphabetical Listings;E-F;Stable Isotopes | | Mol File: | 362049-63-6.mol |  |
| | Ethylene-d4 carbonate Chemical Properties |
| Melting point | 34-37 °C | | Boiling point | 246 °C | | density | 1.379 g/mL at 25 °C | | solubility | soluble in Chloroform, Ethanol, Ethyl Acetate | | form | Solid | | color | White Low Melting | | InChI | 1S/C3H4O3/c4-3-5-1-2-6-3/h1-2H2/i1D2,2D2 | | InChIKey | KMTRUDSVKNLOMY-LNLMKGTHSA-N | | SMILES | [2H]C1([2H])OC(=O)OC1([2H])[2H] | | CAS Number Unlabeled | 96-49-1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Ethylene-d4 carbonate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Labelled 1,3-Dioxolan-2-one (D486525). Ethylene carbonate is an ester of ethylene glycol and carbonic acid. Ethylene carbonate is used as a polar solvent with a molecular dipole moment of 4.9 D, only 0.1 D lower than that of propylene carbonate. It can be used as a high permittivity component of electrolytes in lithium batteries. | | Uses | Ethylene-d4 Carbonate is an ester of ethylene glycol and carbonic acid. It is used as a polar solvent with a molecular dipole moment of 4.9 D, only 0.1 D lower than that of propylene carbonate. It can be used as a high permittivity component of electrolytes in lithium batteries. |
| | Ethylene-d4 carbonate Preparation Products And Raw materials |
|