2-(2-bromo-5-methoxyphenyl)acetonitrile manufacturers
|
| | 2-(2-bromo-5-methoxyphenyl)acetonitrile Basic information |
| Product Name: | 2-(2-bromo-5-methoxyphenyl)acetonitrile | | Synonyms: | 2-(2-bromo-5-methoxyphenyl)acetonitrile;2-BroMo-5-Methoxybenzyl cyanide;2-Bromo-5-methoxyphenylacetonitrile;Benzeneacetonitrile, 2-bromo-5-methoxy-;2-Bromo-5-Methoxyacetonitrile | | CAS: | 27387-23-1 | | MF: | C9H8BrNO | | MW: | 226.07 | | EINECS: | | | Product Categories: | | | Mol File: | 27387-23-1.mol |  |
| | 2-(2-bromo-5-methoxyphenyl)acetonitrile Chemical Properties |
| Boiling point | 325.3±27.0 °C(Predicted) | | density | 1.450±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H8BrNO/c1-12-8-2-3-9(10)7(6-8)4-5-11/h2-3,6H,4H2,1H3 | | InChIKey | VSSZEBGUCILFSV-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC(OC)=CC=C1Br |
| | 2-(2-bromo-5-methoxyphenyl)acetonitrile Usage And Synthesis |
| | 2-(2-bromo-5-methoxyphenyl)acetonitrile Preparation Products And Raw materials |
|