| Company Name: |
VDM Biochemicals
|
| Tel: |
0330-2528181 |
| Email: |
sales@vdmbio.com |
| Products Intro: |
Product Name:Necrosis Inhibitor, IM-54
CAS:861891-50-1
Purity:>=95%
|
Necrosis Inhibitor, IM-54 manufacturers
- IM-54
-
- $45.00
-
2026-07-15
- CAS:861891-50-1
- Purity: 99.24%
- Supply Ability: 10g
|
| | Necrosis Inhibitor, IM-54 Basic information |
| Product Name: | Necrosis Inhibitor, IM-54 | | Synonyms: | Necrosis Inhibitor, IM-54;IM-54;1-Methyl-3-(1-methyl-1H-indol-3-yl)-4-(pentylamino)-1H-pyrrole-2,5-dione;2-(1H-Indol-3-yl)-3-pentylamino-maleimide;1-methyl-3-(1-methylindol-3-yl)-4-(pentylamino)pyrrole-2,5-dione;IM 54 (2-(1H-Indol-3-yl)-3-pentylamino-maleimide);Necrosis Inhibitor, IM-54 - CAS 861891-50-1 - Calbiochem;1H-Pyrrole-2,5-dione, 1-methyl-3-(1-methyl-1H-indol-3-yl)-4-(pentylamino)- | | CAS: | 861891-50-1 | | MF: | C19H23N3O2 | | MW: | 325.4 | | EINECS: | 804-593-4 | | Product Categories: | Apoptosis Inhibitors | | Mol File: | 861891-50-1.mol |  |
| | Necrosis Inhibitor, IM-54 Chemical Properties |
| Boiling point | 511.5±50.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble5mg/mL (clear solution) | | form | Yellow orange solid | | pka | 1.96±0.20(Predicted) | | color | light orange to dark orange | | InChI | 1S/C19H23N3O2/c1-4-5-8-11-20-17-16(18(23)22(3)19(17)24)14-12-21(2)15-10-7-6-9-13(14)15/h6-7,9-10,12,20H,4-5,8,11H2,1-3H3 | | InChIKey | SGLOMINNEBLJFF-UHFFFAOYSA-N | | SMILES | CCCCCNC1=C(C(=O)N(C)C1=O)c2cn(C)c3ccccc23 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 11 - Combustible Solids |
| | Necrosis Inhibitor, IM-54 Usage And Synthesis |
| Uses | Necrosis Inhibitor, IM-54 is a selective inhibitor of oxidative stress-induced necrotic cell death. | | Definition | ChEBI: IM-54 is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid. | | Biological Activity | IM-54 is a cell permeable, potent and selective inhibitor of necrosis. The compound inhibits necrosis induced by oxidative stress. IM-54 does not inhibit apoptosis induced by anticancer drugs. |
| | Necrosis Inhibitor, IM-54 Preparation Products And Raw materials |
|