| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methyl-6-chloronicotinic acid Basic information |
| Product Name: | 4-Methyl-6-chloronicotinic acid | | Synonyms: | 6-Chloro-4-methylpyridine-3-carboxylic acid, 5-Carboxy-2-chloro-4-methylpyridine;6-Chloro-4-Methyl-3-pyridinecarboxylic acid;2-Chloro-4-methylpyridine-5-carboxylic acid;3-Pyridinecarboxylic acid, 6-chloro-4-methyl-;6-Chloro-4-methyla-c3i-dpyridinecarboxylic;6-Chloro-4-methylnicotinic acid;6-Chloro-4-methylpyridine-3-carboxylic acid;4-Methyl-6-chloronicotinic acid | | CAS: | 503555-50-8 | | MF: | C7H6ClNO2 | | MW: | 171.58 | | EINECS: | | | Product Categories: | | | Mol File: | 503555-50-8.mol |  |
| | 4-Methyl-6-chloronicotinic acid Chemical Properties |
| Boiling point | 344.8±37.0 °C(Predicted) | | density | 1.390±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.79±0.25(Predicted) | | form | powder | | color | Yellow | | InChI | InChI=1S/C7H6ClNO2/c1-4-2-6(8)9-3-5(4)7(10)11/h2-3H,1H3,(H,10,11) | | InChIKey | ZCLFIXIHOWGYDY-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC(C)=C1C(O)=O |
| RIDADR | UN2811 | | HS Code | 2933399990 |
| | 4-Methyl-6-chloronicotinic acid Usage And Synthesis |
| | 4-Methyl-6-chloronicotinic acid Preparation Products And Raw materials |
|