|
|
| | tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Basic information |
| Product Name: | tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate | | Synonyms: | tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate;Hexahydrocyclopenta[c]pyrrol-4(1H)-one,N-BOCprotected;tert-Butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H);4-Oxohexahydrocyclopenta[c]pyrrole-2-carboxylic acid tert-butyl ester - X5991;cis-2-boc-hexahydrocyclopenta[c]pyrrol-4(1h)-one;Cyclopenta[c]pyrrole-2(1H)-carboxylic acid, hexahydro-4-oxo-, 1,1-dimethylethyl ester;tert-butyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate;4-Oxohexahydrocyclopenta[c]pyrrole-2-carboxylic acid tert-butyl ester | | CAS: | 879686-42-7 | | MF: | C12H19NO3 | | MW: | 225.28 | | EINECS: | | | Product Categories: | | | Mol File: | 879686-42-7.mol | ![tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Structure](CAS/GIF/879686-42-7.gif) |
| | tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Chemical Properties |
| Boiling point | 325.8±25.0 °C(Predicted) | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -0.87±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C12H19NO3/c1-12(2,3)16-11(15)13-6-8-4-5-10(14)9(8)7-13/h8-9H,4-7H2,1-3H3 | | InChIKey | MZQZNAQWIOWKSR-UHFFFAOYSA-N | | SMILES | O=C(OC(C)(C)C)N1CC(C(CC2)=O)C2C1 |
| WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Usage And Synthesis |
| | tert-butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Preparation Products And Raw materials |
|