| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% CAS:1091606-67-5 Purity:min. 97% Package:100mg;500mg
|
| Company Name: |
Meryer (Shanghai) Chemical Technology Co., Ltd.
|
| Tel: |
4006356688 18621169109 |
| Email: |
market03@meryer.com |
| Products Intro: |
Product Name:(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylaMine CAS:1091606-67-5 Purity:97% Remarks:43409
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:(S,S)-(+)-2-Diphenylphosphino-1,2-diphenylethylaMine, 97+% CAS:1091606-67-5 Package:250Mg Remarks:H60702
|
|
| | (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% Basic information |
| Product Name: | (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% | | Synonyms: | (S,S)-(+)-2-Diphenylphosphino-1,2-diphenylethylaMine, 97+%;(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine kanata purity;(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97%;(1S,2S)-2-(DIPHENYLPHOSPHINO)-1,2-DIPHENYLETHYLAMINE,MIN.97%;(1S,2S)-2-(DIPHENYLPHOSPHINO)-1,2-DIPHENYLETHANAMINE;Benzeneethanamine, β-(diphenylphosphino)-α-phenyl-, (αS,βS)-;(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine,97%;(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine | | CAS: | 1091606-67-5 | | MF: | C26H24NP | | MW: | 381.45 | | EINECS: | | | Product Categories: | Chiral Phosphine | | Mol File: | 1091606-67-5.mol |  |
| | (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% Chemical Properties |
| Melting point | 87-93°C | | Boiling point | 517.2±50.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.12±0.10(Predicted) | | form | Crystalline Powder | | color | White to yellow | | Optical Rotation | [α]22/D +179°, c = 0.5 in chloroform | | Sensitive | air sensitive | | InChI | 1S/C26H24NP/c27-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H,27H2/t25-,26-/m0/s1 | | InChIKey | MIPGTOGPLXZBQX-UIOOFZCWSA-N | | SMILES | N[C@H]([C@@H](P(c1ccccc1)c2ccccc2)c3ccccc3)c4ccccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% Usage And Synthesis |
| | (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% Preparation Products And Raw materials |
|