| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine, min. 97% Basic information |
| Product Name: | (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine, min. 97% | | Synonyms: | (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine, min. 97%;(1S,2S)-(2-AMino-1-phenylpropyl)diphenylphosphine kanata purity;(1S,2S)-1-(Diphenylphosphino)-1-phenylpropan-2-amine;(S,S)-(+)-2-AMino-1-phenylpropyldiphenylphosphine, 97+%;(alphaS,betaS)-beta-(Diphenylphosphino)-alpha-methylbenzeneethanamine;(1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine,min.97%;(1S,2S)-1-diphenylphosphanyl-1-phenylpropan-2-amine;Benzeneethanamine, β-(diphenylphosphino)-α-methyl-, (αS,βS)- | | CAS: | 341968-71-6 | | MF: | C21H22NP | | MW: | 319.39 | | EINECS: | | | Product Categories: | Chiral Phosphine | | Mol File: | 341968-71-6.mol |  |
| | (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine, min. 97% Chemical Properties |
| Melting point | 100-107℃ | | Boiling point | 450.0±38.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Crystalline Powder | | pka | 8.87±0.10(Predicted) | | color | White to yellow | | Optical Rotation | [α]22/D +116°, c = 0.5 in chloroform | | Sensitive | Air Sensitive | | InChI | 1S/C21H22NP/c1-17(22)21(18-11-5-2-6-12-18)23(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21H,22H2,1H3/t17-,21+/m0/s1 | | InChIKey | JWZAIGGNEGTDMG-LAUBAEHRSA-N | | SMILES | C[C@H](N)[C@@H](P(c1ccccc1)c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN 3335 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine, min. 97% Usage And Synthesis |
| | (1S,2S)-2-Amino-1-phenylpropyldiphenylphosphine, min. 97% Preparation Products And Raw materials |
|