|
|
| | OMeprazole N-Methyl 5-Methoxy Analog Basic information | | Synthesis |
| | OMeprazole N-Methyl 5-Methoxy Analog Chemical Properties |
| Melting point | 132-135°C | | Boiling point | 585.8±60.0 °C(Predicted) | | density | 1.30 | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.74±0.40(Predicted) | | color | White to Light Brown | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C18H21N3O3S/c1-11-9-19-15(12(2)17(11)24-5)10-25(22)18-20-14-8-13(23-4)6-7-16(14)21(18)3/h6-9H,10H2,1-5H3 | | InChIKey | RUGQJBJNYIHOIW-UHFFFAOYSA-N | | SMILES | C1(S(CC2=NC=C(C)C(OC)=C2C)=O)N(C)C2=CC=C(OC)C=C2N=1 |
| WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | OMeprazole N-Methyl 5-Methoxy Analog Usage And Synthesis |
| Synthesis |  A solution of dimethyl sulfate (2.0 equivalents) in CH2Cl2 was added to a solution of esomeprazole and DBU (1,8-diazabicyclo-[5.4.0]undec-7-ene, 1.2 equivalents) at room temperature. The mixture was then stirred while monitoring the reaction by thin-layer chromatography. After the reaction was complete, water was added to the reaction mixture and it was stirred vigorously for 30 minutes. The mixture was then extracted with CH₂Cl₂, the organic layer was washed with 1N NaHCO₃ and water, dried over anhydrous MgSO₄, and concentrated on a rotary evaporator. The resulting oil was purified by short silica gel column chromatography (CH₂Cl₂ to 2% MeOH CH₂Cl₂ solution) to give OMeprazole N-Methyl 5-Methoxy Analog. | | Chemical Properties | Light Tan Solid | | Uses | (5-Desmethoxy-6-methoxy) 1-N-Methyl Omeprazole is an impurity of Omeprazole (O635000). Omeprazole covalently binds to proton pump. It inhibits gastric secretion and it is used as an anttiulcerative. | | Uses | Omeprazole (O635000) impurity. |
| | OMeprazole N-Methyl 5-Methoxy Analog Preparation Products And Raw materials |
|