|
|
| | N'-(1-Methylazepan-4-yl)benzohydrazine Basic information |
| | N'-(1-Methylazepan-4-yl)benzohydrazine Chemical Properties |
| Melting point | >78°C (dec.) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | color | Pale Yellow to Dark Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C14H21N3O.ClH/c1-17-10-5-8-13(9-11-17)15-16-14(18)12-6-3-2-4-7-12;/h2-4,6-7,13,15H,5,8-11H2,1H3,(H,16,18);1H | | InChIKey | LBMOWZCEDIZQOM-UHFFFAOYSA-N | | SMILES | Cl.N1(CCC(CCC1)NNC(=O)c2ccccc2)C |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | N'-(1-Methylazepan-4-yl)benzohydrazine Usage And Synthesis |
| Uses | An intermediate in the preparation of Azelastine (A808250). | | Uses | An intermediate in the preparation of Azelastine (A808250(P)), which is an orally active H1-hystamine receptor antagonist and an antihistaminic. |
| | N'-(1-Methylazepan-4-yl)benzohydrazine Preparation Products And Raw materials |
|