5,6-trans Travoprost manufacturers
- 5,6-trans Travoprost
-
-
2026-09-11
- CAS:1563176-59-9
- Min. Order: 1G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | 5,6-trans Travoprost Basic information |
| Product Name: | 5,6-trans Travoprost | | Synonyms: | 5,6-trans Travoprost;Travoprost Impurity 2（5,6-trans-Travoprost）;(5E)-7-[(1R,3R,3R,5S)-3,5-dihydroxy-2-[(1E,3R)-3-hydroxy-4-[3-(trifluoroMethyl)phenoxy]-1-buten-1-yl]cyclopentyl]-5-heptenoic Acid 1-Methylethyl Ester;(5E)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl]cyclopentyl]-5-heptenoic acid 1-methylethyl ester;MKPLKVHSHYCHOC-JPVYXPJZSA-N;5,6-trans-Travoprost/(5E)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl]cyclopentyl]-5-heptenoic acid 1-methylethyl ester;5-Heptenoic acid, 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl]cyclopentyl]-, 1-methylethyl ester, (5E)-;Travoprost Impurity 29 | | CAS: | 1563176-59-9 | | MF: | C26H35F3O6 | | MW: | 500.55 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Agonists;Chiral Reagents;Impurities | | Mol File: | 1563176-59-9.mol |  |
| | 5,6-trans Travoprost Chemical Properties |
| Boiling point | 584.8±50.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Oil | | pka | 13.43±0.20(Predicted) | | color | Clear Colorless to Pale Yellow Thick | | InChIKey | MKPLKVHSHYCHOC-JPVYXPJZSA-N | | SMILES | C(OC(C)C)(=O)CCC/C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)COC1=CC=CC(C(F)(F)F)=C1 |
| | 5,6-trans Travoprost Usage And Synthesis |
| Uses | An 5,6-trans isomeric impurity of the selective FP prostaglandin receptor agonist Travoprost (T715600). |
| | 5,6-trans Travoprost Preparation Products And Raw materials |
|