4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine manufacturers
|
| | 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine Basic information |
| Product Name: | 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine | | Synonyms: | 4-(4'-Methyl-[2,2'-bipyridin]-4-yl)butanoic acid;4'-Methyl[2,2'-bipyridine]-4-butanoic acid;4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine;2,2'-Bipyridine]-4-butanoic acid, 4'-methyl-;4-(4'-Methyl-2,2'-bipyridin-4-yl)butyric acid | | CAS: | 114527-28-5 | | MF: | C15H16N2O2 | | MW: | 256.3 | | EINECS: | | | Product Categories: | | | Mol File: | 114527-28-5.mol |  |
| | 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine Chemical Properties |
| Melting point | 107-109 °C | | Boiling point | 447.4±40.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 4.58±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H16N2O2/c1-11-5-7-16-13(9-11)14-10-12(6-8-17-14)3-2-4-15(18)19/h5-10H,2-4H2,1H3,(H,18,19) | | InChIKey | LFMPLEMXVCGLMX-UHFFFAOYSA-N | | SMILES | C1(C2=NC=CC(C)=C2)=NC=CC(CCCC(O)=O)=C1 | | CAS DataBase Reference | 114527-28-5 |
| | 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine Usage And Synthesis |
| | 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine Preparation Products And Raw materials |
|