| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(2-Chloroethoxy)benzaldehyde Basic information |
| | 4-(2-Chloroethoxy)benzaldehyde Chemical Properties |
| Melting point | 25-30°C | | Boiling point | 138-142 °C(Press: 2 Torr) | | density | 1.2246 g/cm3(Temp: 25 °C) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C9H9ClO2/c10-5-6-12-9-3-1-8(7-11)2-4-9/h1-4,7H,5-6H2 | | InChIKey | HBHHMVNKQWECIS-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OCCCl)C=C1 |
| | 4-(2-Chloroethoxy)benzaldehyde Usage And Synthesis |
| | 4-(2-Chloroethoxy)benzaldehyde Preparation Products And Raw materials |
|