| Company Name: |
Abosyn Gold |
| Tel: |
0512-69561983 13914027025 |
| Email: |
he_qf@medinoah.com |
(1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester manufacturers
|
| | (1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester Basic information |
| Product Name: | (1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester | | Synonyms: | (1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester;tert-Butyl (trans-4-(MethylaMino)cyclohexyl)carbaMate;tert-butyl N-[trans-4-(methylamino)cyclohexyl]carbamate;TRANS-(4-METHYLAMINO-CYCLOHEXYL)-CARBAMIC ACID TERT-BUTYL ESTER;Carbamic acid, [trans-4-(methylamino)cyclohexyl]-, 1,1-dimethylethyl ester;Carbamic acid, [trans-4-(methylamino)cyclohexyl]-, 1,1-dimethylethyl ester (9CI);ert-butyl (1r,4r)-4-(methylamino)cyclohexylcarbamate;trans-N1-Boc-N4-methylcyclohexane-1,4-diamine | | CAS: | 294180-29-3 | | MF: | C12H24N2O2 | | MW: | 228.33 | | EINECS: | | | Product Categories: | | | Mol File: | 294180-29-3.mol |  |
| | (1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester Chemical Properties |
| Boiling point | 331.9±31.0 °C(Predicted) | | density | 0.99±0.1 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 12.48±0.40(Predicted) | | Appearance | white solid | | InChI | InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-10-7-5-9(13-4)6-8-10/h9-10,13H,5-8H2,1-4H3,(H,14,15)/t9-,10- | | InChIKey | TUUNNJSATKVNGO-MGCOHNPYSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CC[C@@H](NC)CC1 |
| | (1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester Usage And Synthesis |
| | (1R,4R)-(4-MethylaMino-cyclohexyl)-carbaMic acid tert-butyl ester Preparation Products And Raw materials |
|