|
|
| | Ethyl 4-(4-Fluorophenyl)-2-thiazolecarboxylate Basic information |
| Product Name: | Ethyl 4-(4-Fluorophenyl)-2-thiazolecarboxylate | | Synonyms: | Ethyl 4-(4-Fluorophenyl)-2-thiazolecarboxylate;JR-14102, Ethyl 4-(4-fluorophenyl)thiazole-2-carboxylate, 97%;2-Thiazolecarboxylic acid, 4-(4-fluorophenyl)-, ethyl ester;4-(4-Fluorophenyl)-2-thiazolecarboxylic acid ethyl ester | | CAS: | 886366-37-6 | | MF: | C12H10FNO2S | | MW: | 251.28 | | EINECS: | | | Product Categories: | | | Mol File: | 886366-37-6.mol |  |
| | Ethyl 4-(4-Fluorophenyl)-2-thiazolecarboxylate Chemical Properties |
| Boiling point | 367.5±34.0 °C(Predicted) | | density | 1.281±0.06 g/cm3(Predicted) | | pka | -0.35±0.10(Predicted) | | form | solid | | InChI | 1S/C12H10FNO2S/c1-2-16-12(15)11-14-10(7-17-11)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3 | | InChIKey | GUUPIAOHATZXPK-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=NC(C(C=C2)=CC=C2F)=CS1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Ethyl 4-(4-Fluorophenyl)-2-thiazolecarboxylate Usage And Synthesis |
| | Ethyl 4-(4-Fluorophenyl)-2-thiazolecarboxylate Preparation Products And Raw materials |
|